C8H15NO3 — CID 143229288
ethane;6-oxopiperidine-2-carboxylic acid (PubChem CID 143229288) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is ethane;6-oxopiperidine-2-carboxylic acid.
| Compound Name | ethane;6-oxopiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 143229288 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | ethane;6-oxopiperidine-2-carboxylic acid |
| SMILES | CC.O=C1CCCC(C(=O)O)N1 |
| InChI | InChI=1S/C6H9NO3.C2H6/c8-5-3-1-2-4(7-5)6(9)10;1-2/h4H,1-3H2,(H,7,8)(H,9,10);1-2H3 |
| InChIKey | PNACSFFOHKYKOW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |