ethane;6-oxopiperidine-2-carboxylic acid

C8H15NO3 — CID 143229288

IUPACethane;6-oxopiperidine-2-carboxylic acid
SMILESCC.O=C1CCCC(C(=O)O)N1
InChIInChI=1S/C6H9NO3.C2H6/c8-5-3-1-2-4(7-5)6(9)10;1-2/h4H,1-3H2,(H,7,8)(H,9,10);1-2H3
InChIKeyPNACSFFOHKYKOW-UHFFFAOYSA-N
MW173.21 g/mol
LogP0.77
Rot. Bonds1

About ethane;6-oxopiperidine-2-carboxylic acid

ethane;6-oxopiperidine-2-carboxylic acid (PubChem CID 143229288) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is ethane;6-oxopiperidine-2-carboxylic acid.

Molecular Properties

Compound Nameethane;6-oxopiperidine-2-carboxylic acid
PubChem CID143229288
Molecular FormulaC8H15NO3
Molecular Weight173.21 g/mol
Exact Mass173.11
IUPAC Nameethane;6-oxopiperidine-2-carboxylic acid
SMILESCC.O=C1CCCC(C(=O)O)N1
InChIInChI=1S/C6H9NO3.C2H6/c8-5-3-1-2-4(7-5)6(9)10;1-2/h4H,1-3H2,(H,7,8)(H,9,10);1-2H3
InChIKeyPNACSFFOHKYKOW-UHFFFAOYSA-N
XLogP0.77
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.21
LogP ≤ 50.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze ethane;6-oxopiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;6-oxopiperidine-2-carboxylic acid?
The IUPAC name of ethane;6-oxopiperidine-2-carboxylic acid (CID 143229288) is ethane;6-oxopiperidine-2-carboxylic acid.
What is the SMILES notation for ethane;6-oxopiperidine-2-carboxylic acid?
The canonical SMILES for ethane;6-oxopiperidine-2-carboxylic acid is CC.O=C1CCCC(C(=O)O)N1.
What is the InChIKey of ethane;6-oxopiperidine-2-carboxylic acid?
The InChIKey is PNACSFFOHKYKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.C2H6/c8-5-3-1-2-4(7-5)6(9)10;1-2/h4H,1-3H2,(H,7,8)(H,9,10);1-2H3.
What are the key properties of ethane;6-oxopiperidine-2-carboxylic acid?
ethane;6-oxopiperidine-2-carboxylic acid has a molecular weight of 173.21 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-oxopiperidine-2-carboxylic acid is sourced from PubChem (CID 143229288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).