C16H24N4O7S3 — CID 123261073
(5R,14S,17R)-14-methyl-7,10,13,16-tetraoxo-17-(2-oxopropyl)-1,2,3-trithia-6,9,12,15-tetrazacyclooctadecane-5-carboxylic acid (PubChem CID 123261073) has the molecular formula C16H24N4O7S3 and a molecular weight of 480.59 g/mol. Its IUPAC name is (5R,14S,17R)-14-methyl-7,10,13,16-tetraoxo-17-(2-oxopropyl)-1,2,3-trithia-6,9,12,15-tetrazacyclooctadecane-5-carboxylic acid.
| Compound Name | (5R,14S,17R)-14-methyl-7,10,13,16-tetraoxo-17-(2-oxopropyl)-1,2,3-trithia-6,9,12,15-tetrazacyclooctadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 123261073 |
| Molecular Formula | C16H24N4O7S3 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (5R,14S,17R)-14-methyl-7,10,13,16-tetraoxo-17-(2-oxopropyl)-1,2,3-trithia-6,9,12,15-tetrazacyclooctadecane-5-carboxylic acid |
| SMILES | CC(=O)C[C@H]1CSSSC[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C16H24N4O7S3/c1-8(21)3-10-6-28-30-29-7-11(16(26)27)20-13(23)5-17-12(22)4-18-14(24)9(2)19-15(10)25/h9-11H,3-7H2,1-2H3,(H,17,22)(H,18,24)(H,19,25)(H,20,23)(H,26,27)/t9-,10-,11-/m0/s1 |
| InChIKey | DPQQTFAXLGNOLD-DCAQKATOSA-N |
| XLogP | -1.07 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|