C22H39N7O7S2 — CID 71462306
(4R,7S,10S,19R)-19-amino-10-(4-aminobutyl)-7-(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxylic acid (PubChem CID 71462306) has the molecular formula C22H39N7O7S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is (4R,7S,10S,19R)-19-amino-10-(4-aminobutyl)-7-(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxylic acid.
| Compound Name | (4R,7S,10S,19R)-19-amino-10-(4-aminobutyl)-7-(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxylic acid |
|---|---|
| PubChem CID | 71462306 |
| Molecular Formula | C22H39N7O7S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (4R,7S,10S,19R)-19-amino-10-(4-aminobutyl)-7-(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxylic acid |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CSSC[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C22H39N7O7S2/c1-12(2)7-15-21(34)29-16(22(35)36)11-38-37-10-13(24)19(32)26-8-17(30)25-9-18(31)27-14(20(33)28-15)5-3-4-6-23/h12-16H,3-11,23-24H2,1-2H3,(H,25,30)(H,26,32)(H,27,31)(H,28,33)(H,29,34)(H,35,36)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | VHTLGWVTBOFRQO-VGWMRTNUSA-N |
| XLogP | -2.34 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|