C26H49N5O4 — CID 10530284
(3S,6S,13R)-6-(4-aminobutyl)-3-(2-methylpropyl)-13-nonyl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone (PubChem CID 10530284) has the molecular formula C26H49N5O4 and a molecular weight of 495.71 g/mol. Its IUPAC name is (3S,6S,13R)-6-(4-aminobutyl)-3-(2-methylpropyl)-13-nonyl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,13R)-6-(4-aminobutyl)-3-(2-methylpropyl)-13-nonyl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 10530284 |
| Molecular Formula | C26H49N5O4 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.38 |
| IUPAC Name | (3S,6S,13R)-6-(4-aminobutyl)-3-(2-methylpropyl)-13-nonyl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCCCCCC[C@@H]1CC(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C26H49N5O4/c1-4-5-6-7-8-9-10-13-20-17-23(32)28-18-24(33)30-21(14-11-12-15-27)25(34)31-22(16-19(2)3)26(35)29-20/h19-22H,4-18,27H2,1-3H3,(H,28,32)(H,29,35)(H,30,33)(H,31,34)/t20-,21+,22+/m1/s1 |
| InChIKey | NYLNGJMBVNJETD-FSSWDIPSSA-N |
| XLogP | 2.28 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|