C26H47N3O5 — CID 163160835
3,6,9-tris(2-methylpropyl)-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 163160835) has the molecular formula C26H47N3O5 and a molecular weight of 481.68 g/mol. Its IUPAC name is 3,6,9-tris(2-methylpropyl)-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | 3,6,9-tris(2-methylpropyl)-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 163160835 |
| Molecular Formula | C26H47N3O5 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.35 |
| IUPAC Name | 3,6,9-tris(2-methylpropyl)-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCCC1CC(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)O1 |
| InChI | InChI=1S/C26H47N3O5/c1-8-9-10-11-19-15-23(30)27-20(12-16(2)3)24(31)28-21(13-17(4)5)25(32)29-22(14-18(6)7)26(33)34-19/h16-22H,8-15H2,1-7H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | QXKXHOSRJREABJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|