C24H42N2O8 — CID 24850248
trans-(3S,10S)-7,14-dihexyl-3,10-bis(hydroxymethyl)-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone (PubChem CID 24850248) has the molecular formula C24H42N2O8 and a molecular weight of 486.61 g/mol. Its IUPAC name is trans-(3S,10S)-7,14-dihexyl-3,10-bis(hydroxymethyl)-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone.
| Compound Name | trans-(3S,10S)-7,14-dihexyl-3,10-bis(hydroxymethyl)-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 24850248 |
| Molecular Formula | C24H42N2O8 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | trans-(3S,10S)-7,14-dihexyl-3,10-bis(hydroxymethyl)-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone |
| SMILES | CCCCCCC1CC(=O)N[C@@H](CO)C(=O)OC(CCCCCC)CC(=O)N[C@@H](CO)C(=O)O1 |
| InChI | InChI=1S/C24H42N2O8/c1-3-5-7-9-11-17-13-21(29)25-20(16-28)24(32)34-18(12-10-8-6-4-2)14-22(30)26-19(15-27)23(31)33-17/h17-20,27-28H,3-16H2,1-2H3,(H,25,29)(H,26,30)/t17?,18?,19-,20-/m0/s1 |
| InChIKey | WSMFKETWQNCLPY-GUMHCPJTSA-N |
| XLogP | 1.50 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|