C26H45N3O5 — CID 11691489
(3R,6S,9S,13R)-3-[(2S)-butan-2-yl]-9-(cyclohexylmethyl)-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 11691489) has the molecular formula C26H45N3O5 and a molecular weight of 479.66 g/mol. Its IUPAC name is (3R,6S,9S,13R)-3-[(2S)-butan-2-yl]-9-(cyclohexylmethyl)-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13R)-3-[(2S)-butan-2-yl]-9-(cyclohexylmethyl)-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 11691489 |
| Molecular Formula | C26H45N3O5 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | (3R,6S,9S,13R)-3-[(2S)-butan-2-yl]-9-(cyclohexylmethyl)-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCC[C@@H]1CC(=O)N[C@@H](CC2CCCCC2)C(=O)N[C@@H](C)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C26H45N3O5/c1-5-7-9-14-20-16-22(30)28-21(15-19-12-10-8-11-13-19)25(32)27-18(4)24(31)29-23(17(3)6-2)26(33)34-20/h17-21,23H,5-16H2,1-4H3,(H,27,32)(H,28,30)(H,29,31)/t17-,18-,20+,21-,23+/m0/s1 |
| InChIKey | YORVVLSFGMBGPQ-VQYHNWKHSA-N |
| XLogP | 3.37 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|