C27H40BrN3O5 — CID 11649839
(3R,6S,9S,13S)-9-[(4-bromophenyl)methyl]-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 11649839) has the molecular formula C27H40BrN3O5 and a molecular weight of 566.54 g/mol. Its IUPAC name is (3R,6S,9S,13S)-9-[(4-bromophenyl)methyl]-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13S)-9-[(4-bromophenyl)methyl]-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 11649839 |
| Molecular Formula | C27H40BrN3O5 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | (3R,6S,9S,13S)-9-[(4-bromophenyl)methyl]-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](Cc2ccc(Br)cc2)C(=O)N[C@@H](C)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C27H40BrN3O5/c1-6-8-9-17(4)22-15-23(32)30-21(14-19-10-12-20(28)13-11-19)26(34)29-18(5)25(33)31-24(16(3)7-2)27(35)36-22/h10-13,16-18,21-22,24H,6-9,14-15H2,1-5H3,(H,29,34)(H,30,32)(H,31,33)/t16-,17-,18-,21-,22-,24+/m0/s1 |
| InChIKey | YJJMJMJXUWIAIK-FRBKHAKBSA-N |
| XLogP | 3.65 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |