C34H41N3O5 — CID 46240350
(3R,6S,9R,13R)-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 46240350) has the molecular formula C34H41N3O5 and a molecular weight of 571.72 g/mol. Its IUPAC name is (3R,6S,9R,13R)-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9R,13R)-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 46240350 |
| Molecular Formula | C34H41N3O5 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | (3R,6S,9R,13R)-3-benzyl-13-[(2S)-hexan-2-yl]-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@H]1CC(=O)N[C@H](Cc2ccc3ccccc3c2)C(=O)N[C@@H](C)C(=O)N[C@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C34H41N3O5/c1-4-5-11-22(2)30-21-31(38)36-28(20-25-16-17-26-14-9-10-15-27(26)18-25)33(40)35-23(3)32(39)37-29(34(41)42-30)19-24-12-7-6-8-13-24/h6-10,12-18,22-23,28-30H,4-5,11,19-21H2,1-3H3,(H,35,40)(H,36,38)(H,37,39)/t22-,23-,28+,29+,30+/m0/s1 |
| InChIKey | IMHIOPVVMYZODD-DJJUAZAJSA-N |
| XLogP | 4.24 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |