C29H44N4O6 — CID 44578340
2-[(3R,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-[(2R)-2-methylbutyl]-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-6-yl]acetamide (PubChem CID 44578340) has the molecular formula C29H44N4O6 and a molecular weight of 544.69 g/mol. Its IUPAC name is 2-[(3R,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-[(2R)-2-methylbutyl]-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-6-yl]acetamide.
| Compound Name | 2-[(3R,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-[(2R)-2-methylbutyl]-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-6-yl]acetamide |
|---|---|
| PubChem CID | 44578340 |
| Molecular Formula | C29H44N4O6 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 2-[(3R,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-[(2R)-2-methylbutyl]-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-6-yl]acetamide |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C[C@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C29H44N4O6/c1-5-7-11-19(4)24-17-26(35)31-21(15-20-12-9-8-10-13-20)27(36)32-22(16-25(30)34)28(37)33-23(29(38)39-24)14-18(3)6-2/h8-10,12-13,18-19,21-24H,5-7,11,14-17H2,1-4H3,(H2,30,34)(H,31,35)(H,32,36)(H,33,37)/t18-,19+,21+,22+,23-,24+/m1/s1 |
| InChIKey | VWKYQRFTUODEPK-YNFNHKPXSA-N |
| XLogP | 2.14 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |