C31H45N3O7 — CID 46241911
2-[(3S,6R,9R,13R)-9-benzyl-4-cyclohexyl-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-3-yl]acetic acid (PubChem CID 46241911) has the molecular formula C31H45N3O7 and a molecular weight of 571.72 g/mol. Its IUPAC name is 2-[(3S,6R,9R,13R)-9-benzyl-4-cyclohexyl-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-3-yl]acetic acid.
| Compound Name | 2-[(3S,6R,9R,13R)-9-benzyl-4-cyclohexyl-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-3-yl]acetic acid |
|---|---|
| PubChem CID | 46241911 |
| Molecular Formula | C31H45N3O7 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | 2-[(3S,6R,9R,13R)-9-benzyl-4-cyclohexyl-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-3-yl]acetic acid |
| SMILES | CCCC[C@H](C)[C@H]1CC(=O)N[C@H](Cc2ccccc2)C(=O)N[C@H](C)C(=O)N(C2CCCCC2)[C@@H](CC(=O)O)C(=O)O1 |
| InChI | InChI=1S/C31H45N3O7/c1-4-5-12-20(2)26-19-27(35)33-24(17-22-13-8-6-9-14-22)29(38)32-21(3)30(39)34(23-15-10-7-11-16-23)25(18-28(36)37)31(40)41-26/h6,8-9,13-14,20-21,23-26H,4-5,7,10-12,15-19H2,1-3H3,(H,32,38)(H,33,35)(H,36,37)/t20-,21+,24+,25-,26+/m0/s1 |
| InChIKey | SEGWBDKIGZJUFI-FPRYVRSGSA-N |
| XLogP | 3.37 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |