C31H43N3O5 — CID 11489547
3-butan-2-yl-13-hexan-2-yl-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 11489547) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is 3-butan-2-yl-13-hexan-2-yl-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | 3-butan-2-yl-13-hexan-2-yl-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 11489547 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 3-butan-2-yl-13-hexan-2-yl-6-methyl-9-(naphthalen-2-ylmethyl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCC(C)C1CC(=O)NC(Cc2ccc3ccccc3c2)C(=O)NC(C)C(=O)NC(C(C)CC)C(=O)O1 |
| InChI | InChI=1S/C31H43N3O5/c1-6-8-11-20(4)26-18-27(35)33-25(17-22-14-15-23-12-9-10-13-24(23)16-22)30(37)32-21(5)29(36)34-28(19(3)7-2)31(38)39-26/h9-10,12-16,19-21,25-26,28H,6-8,11,17-18H2,1-5H3,(H,32,37)(H,33,35)(H,34,36) |
| InChIKey | LJIKAZZXJQENRB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |