C35H49N3O7 — CID 164617559
(3R,6S,9S,13S)-3-[(2S)-butan-2-yl]-6,9-bis[(4-hydroxyphenyl)methyl]-13-octan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 164617559) has the molecular formula C35H49N3O7 and a molecular weight of 623.79 g/mol. Its IUPAC name is (3R,6S,9S,13S)-3-[(2S)-butan-2-yl]-6,9-bis[(4-hydroxyphenyl)methyl]-13-octan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13S)-3-[(2S)-butan-2-yl]-6,9-bis[(4-hydroxyphenyl)methyl]-13-octan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 164617559 |
| Molecular Formula | C35H49N3O7 |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | (3R,6S,9S,13S)-3-[(2S)-butan-2-yl]-6,9-bis[(4-hydroxyphenyl)methyl]-13-octan-2-yl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCCCC(C)[C@@H]1CC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C35H49N3O7/c1-5-7-8-9-10-23(4)30-21-31(41)36-28(19-24-11-15-26(39)16-12-24)33(42)37-29(20-25-13-17-27(40)18-14-25)34(43)38-32(22(3)6-2)35(44)45-30/h11-18,22-23,28-30,32,39-40H,5-10,19-21H2,1-4H3,(H,36,41)(H,37,42)(H,38,43)/t22-,23?,28-,29-,30-,32+/m0/s1 |
| InChIKey | FMFHPIYMSBBMAH-ALYUFJSJSA-N |
| XLogP | 4.31 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|