C28H40N4O5 — CID 70881916
2-[[(3R,6S,9R,13S)-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-9-yl]methyl]benzonitrile (PubChem CID 70881916) has the molecular formula C28H40N4O5 and a molecular weight of 512.65 g/mol. Its IUPAC name is 2-[[(3R,6S,9R,13S)-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-9-yl]methyl]benzonitrile.
| Compound Name | 2-[[(3R,6S,9R,13S)-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-9-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 70881916 |
| Molecular Formula | C28H40N4O5 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 2-[[(3R,6S,9R,13S)-3-[(2S)-butan-2-yl]-13-[(2S)-hexan-2-yl]-6-methyl-2,5,8,11-tetraoxo-1-oxa-4,7,10-triazacyclotridec-9-yl]methyl]benzonitrile |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@H](Cc2ccccc2C#N)C(=O)N[C@@H](C)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C28H40N4O5/c1-6-8-11-18(4)23-15-24(33)31-22(14-20-12-9-10-13-21(20)16-29)27(35)30-19(5)26(34)32-25(17(3)7-2)28(36)37-23/h9-10,12-13,17-19,22-23,25H,6-8,11,14-15H2,1-5H3,(H,30,35)(H,31,33)(H,32,34)/t17-,18-,19-,22+,23-,25+/m0/s1 |
| InChIKey | INSIFWQZHSFTFY-QKSNPGTDSA-N |
| XLogP | 2.76 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |