C29H44N2O5 — CID 159046376
(2S,6S,9S,12R)-6-benzyl-2-[(2S)-hexan-2-yl]-9-methyl-12-[(2S)-3-methylbutan-2-yl]-1-oxa-5,8-diazacyclotridecane-4,7,10,13-tetrone (PubChem CID 159046376) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is (2S,6S,9S,12R)-6-benzyl-2-[(2S)-hexan-2-yl]-9-methyl-12-[(2S)-3-methylbutan-2-yl]-1-oxa-5,8-diazacyclotridecane-4,7,10,13-tetrone.
| Compound Name | (2S,6S,9S,12R)-6-benzyl-2-[(2S)-hexan-2-yl]-9-methyl-12-[(2S)-3-methylbutan-2-yl]-1-oxa-5,8-diazacyclotridecane-4,7,10,13-tetrone |
|---|---|
| PubChem CID | 159046376 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | (2S,6S,9S,12R)-6-benzyl-2-[(2S)-hexan-2-yl]-9-methyl-12-[(2S)-3-methylbutan-2-yl]-1-oxa-5,8-diazacyclotridecane-4,7,10,13-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)C(=O)C[C@H]([C@@H](C)C(C)C)C(=O)O1 |
| InChI | InChI=1S/C29H44N2O5/c1-7-8-12-19(4)26-17-27(33)31-24(15-22-13-10-9-11-14-22)28(34)30-21(6)25(32)16-23(29(35)36-26)20(5)18(2)3/h9-11,13-14,18-21,23-24,26H,7-8,12,15-17H2,1-6H3,(H,30,34)(H,31,33)/t19-,20-,21-,23+,24-,26-/m0/s1 |
| InChIKey | JWRZSILBKLXVDJ-CVVXNRCUSA-N |
| XLogP | 4.23 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |