C28H43N3O6 — CID 44578337
(3R,6S,9R,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-3-[(2S)-2-methylbutyl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 44578337) has the molecular formula C28H43N3O6 and a molecular weight of 517.67 g/mol. Its IUPAC name is (3R,6S,9R,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-3-[(2S)-2-methylbutyl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9R,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-3-[(2S)-2-methylbutyl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44578337 |
| Molecular Formula | C28H43N3O6 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | (3R,6S,9R,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-6-(hydroxymethyl)-3-[(2S)-2-methylbutyl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H](CO)C(=O)N[C@H](C[C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C28H43N3O6/c1-5-7-11-19(4)24-16-25(33)29-21(15-20-12-9-8-10-13-20)26(34)31-23(17-32)27(35)30-22(28(36)37-24)14-18(3)6-2/h8-10,12-13,18-19,21-24,32H,5-7,11,14-17H2,1-4H3,(H,29,33)(H,30,35)(H,31,34)/t18-,19-,21+,22+,23-,24-/m0/s1 |
| InChIKey | PFPFZGPAFPYTGO-VNJSKBGOSA-N |
| XLogP | 2.25 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |