C32H40N4O5 — CID 70881974
(3S,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-(1H-indol-3-ylmethyl)-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 70881974) has the molecular formula C32H40N4O5 and a molecular weight of 560.70 g/mol. Its IUPAC name is (3S,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-(1H-indol-3-ylmethyl)-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-(1H-indol-3-ylmethyl)-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 70881974 |
| Molecular Formula | C32H40N4O5 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | (3S,6S,9S,13S)-9-benzyl-13-[(2S)-hexan-2-yl]-3-(1H-indol-3-ylmethyl)-6-methyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C32H40N4O5/c1-4-5-11-20(2)28-18-29(37)35-26(16-22-12-7-6-8-13-22)31(39)34-21(3)30(38)36-27(32(40)41-28)17-23-19-33-25-15-10-9-14-24(23)25/h6-10,12-15,19-21,26-28,33H,4-5,11,16-18H2,1-3H3,(H,34,39)(H,35,37)(H,36,38)/t20-,21-,26-,27-,28-/m0/s1 |
| InChIKey | CMWBOYMRJPFENT-DHYWSWINSA-N |
| XLogP | 3.57 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |