C28H48N2O8 — CID 163049568
(3S,7R,10S,14R)-7-heptyl-3,10-bis(hydroxymethyl)-14-non-2-enyl-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone (PubChem CID 163049568) has the molecular formula C28H48N2O8 and a molecular weight of 540.70 g/mol. Its IUPAC name is (3S,7R,10S,14R)-7-heptyl-3,10-bis(hydroxymethyl)-14-non-2-enyl-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone.
| Compound Name | (3S,7R,10S,14R)-7-heptyl-3,10-bis(hydroxymethyl)-14-non-2-enyl-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 163049568 |
| Molecular Formula | C28H48N2O8 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | (3S,7R,10S,14R)-7-heptyl-3,10-bis(hydroxymethyl)-14-non-2-enyl-1,8-dioxa-4,11-diazacyclotetradecane-2,5,9,12-tetrone |
| SMILES | CCCCCCC=CC[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCCCC)CC(=O)N[C@@H](CO)C(=O)O1 |
| InChI | InChI=1S/C28H48N2O8/c1-3-5-7-9-10-12-14-16-22-18-26(34)30-23(19-31)27(35)37-21(15-13-11-8-6-4-2)17-25(33)29-24(20-32)28(36)38-22/h12,14,21-24,31-32H,3-11,13,15-20H2,1-2H3,(H,29,33)(H,30,34)/t21-,22-,23+,24+/m1/s1 |
| InChIKey | YMOFMWFDYPVUFF-LWSSLDFYSA-N |
| XLogP | 2.84 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|