C28H53N5O4 — CID 78191940
6-(4-aminobutyl)-13-(10-methylundecyl)-3-propan-2-yl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone (PubChem CID 78191940) has the molecular formula C28H53N5O4 and a molecular weight of 523.76 g/mol. Its IUPAC name is 6-(4-aminobutyl)-13-(10-methylundecyl)-3-propan-2-yl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | 6-(4-aminobutyl)-13-(10-methylundecyl)-3-propan-2-yl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 78191940 |
| Molecular Formula | C28H53N5O4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.41 |
| IUPAC Name | 6-(4-aminobutyl)-13-(10-methylundecyl)-3-propan-2-yl-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CC(C)CCCCCCCCCC1CC(=O)NCC(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)N1 |
| InChI | InChI=1S/C28H53N5O4/c1-20(2)14-10-8-6-5-7-9-11-15-22-18-24(34)30-19-25(35)32-23(16-12-13-17-29)27(36)33-26(21(3)4)28(37)31-22/h20-23,26H,5-19,29H2,1-4H3,(H,30,34)(H,31,37)(H,32,35)(H,33,36) |
| InChIKey | CQVSTNLAGJAEKO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|