C6H9NO3S — CID 99645794
(3S,6R)-6-methyl-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 99645794) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is (3S,6R)-6-methyl-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | (3S,6R)-6-methyl-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 99645794 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | (3S,6R)-6-methyl-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | C[C@H]1SC[C@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C6H9NO3S/c1-3-5(8)7-4(2-11-3)6(9)10/h3-4H,2H2,1H3,(H,7,8)(H,9,10)/t3-,4-/m1/s1 |
| InChIKey | QJFTZLOJRRSNEI-QWWZWVQMSA-N |
| XLogP | -0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |