C7H9F2NO3S — CID 119053753
7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxylic acid (PubChem CID 119053753) has the molecular formula C7H9F2NO3S and a molecular weight of 225.22 g/mol. Its IUPAC name is 7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxylic acid.
| Compound Name | 7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxylic acid |
|---|---|
| PubChem CID | 119053753 |
| Molecular Formula | C7H9F2NO3S |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxylic acid |
| SMILES | O=C1CC(C(F)F)SCC(C(=O)O)N1 |
| InChI | InChI=1S/C7H9F2NO3S/c8-6(9)4-1-5(11)10-3(2-14-4)7(12)13/h3-4,6H,1-2H2,(H,10,11)(H,12,13) |
| InChIKey | LMUFFDLKFQNZPF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |