C7H10F2N2O2S — CID 124676911
(3S,7R)-7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 124676911) has the molecular formula C7H10F2N2O2S and a molecular weight of 224.23 g/mol. Its IUPAC name is (3S,7R)-7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | (3S,7R)-7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 124676911 |
| Molecular Formula | C7H10F2N2O2S |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (3S,7R)-7-(difluoromethyl)-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | NC(=O)[C@H]1CS[C@H](C(F)F)CC(=O)N1 |
| InChI | InChI=1S/C7H10F2N2O2S/c8-6(9)4-1-5(12)11-3(2-14-4)7(10)13/h3-4,6H,1-2H2,(H2,10,13)(H,11,12)/t3-,4+/m1/s1 |
| InChIKey | VIUCADHXTVXWMB-DMTCNVIQSA-N |
| XLogP | -0.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |