C7H11N3O3 — CID 78315101
4-oxopiperidine-2,6-dicarboxamide (PubChem CID 78315101) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 4-oxopiperidine-2,6-dicarboxamide.
| Compound Name | 4-oxopiperidine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 78315101 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-oxopiperidine-2,6-dicarboxamide |
| SMILES | NC(=O)C1CC(=O)CC(C(N)=O)N1 |
| InChI | InChI=1S/C7H11N3O3/c8-6(12)4-1-3(11)2-5(10-4)7(9)13/h4-5,10H,1-2H2,(H2,8,12)(H2,9,13) |
| InChIKey | YPKJWGGXHQVRGH-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |