C4H8N2O — CID 89465194
trans-(1R,2R)-2-aminocyclopropane-1-carboxamide (PubChem CID 89465194) has the molecular formula C4H8N2O and a molecular weight of 100.12 g/mol. Its IUPAC name is trans-(1R,2R)-2-aminocyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-aminocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89465194 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | trans-(1R,2R)-2-aminocyclopropane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@H]1N |
| InChI | InChI=1S/C4H8N2O/c5-3-1-2(3)4(6)7/h2-3H,1,5H2,(H2,6,7)/t2-,3-/m1/s1 |
| InChIKey | NYJLOBSPMAAEBN-PWNYCUMCSA-N |
| XLogP | -1.18 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |