C5H10N2O — CID 97301417
trans-(1S,2S)-2-aminocyclobutane-1-carboxamide (PubChem CID 97301417) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is trans-(1S,2S)-2-aminocyclobutane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-aminocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 97301417 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | trans-(1S,2S)-2-aminocyclobutane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CC[C@@H]1N |
| InChI | InChI=1S/C5H10N2O/c6-4-2-1-3(4)5(7)8/h3-4H,1-2,6H2,(H2,7,8)/t3-,4-/m0/s1 |
| InChIKey | GYCOWFMUOXHPGW-IMJSIDKUSA-N |
| XLogP | -0.79 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |