C7H11NO2 — CID 45084156
trans-(1R,2R)-2-acetylcyclobutane-1-carboxamide (PubChem CID 45084156) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is trans-(1R,2R)-2-acetylcyclobutane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-acetylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 45084156 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | trans-(1R,2R)-2-acetylcyclobutane-1-carboxamide |
| SMILES | CC(=O)[C@@H]1CC[C@H]1C(N)=O |
| InChI | InChI=1S/C7H11NO2/c1-4(9)5-2-3-6(5)7(8)10/h5-6H,2-3H2,1H3,(H2,8,10)/t5-,6+/m0/s1 |
| InChIKey | OIGTYKFSOSSOCJ-NTSWFWBYSA-N |
| XLogP | 0.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |