C6H11NO3 — CID 23103466
2,3-dihydroxycyclopentane-1-carboxamide (PubChem CID 23103466) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2,3-dihydroxycyclopentane-1-carboxamide.
| Compound Name | 2,3-dihydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 23103466 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2,3-dihydroxycyclopentane-1-carboxamide |
| SMILES | NC(=O)C1CCC(O)C1O |
| InChI | InChI=1S/C6H11NO3/c7-6(10)3-1-2-4(8)5(3)9/h3-5,8-9H,1-2H2,(H2,7,10) |
| InChIKey | QFRFCBJNEAOAEX-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |