C6H12O4 — CID 10176209
(1R,2S,3R,4R)-cyclohexane-1,2,3,4-tetrol (PubChem CID 10176209) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is (1R,2S,3R,4R)-cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3R,4R)-cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 10176209 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (1R,2S,3R,4R)-cyclohexane-1,2,3,4-tetrol |
| SMILES | O[C@@H]1[C@H](O)[C@H](O)CC[C@H]1O |
| InChI | InChI=1S/C6H12O4/c7-3-1-2-4(8)6(10)5(3)9/h3-10H,1-2H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | WESBWDZFWNIVRV-KAZBKCHUSA-N |
| XLogP | -1.78 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |