About cyclohexane-1,2,3,4-tetrol;methanol
cyclohexane-1,2,3,4-tetrol;methanol (PubChem CID 70613200) has the molecular formula C7H16O5
and a molecular weight of 180.20 g/mol. Its IUPAC name is cyclohexane-1,2,3,4-tetrol;methanol.
Molecular Properties
| Compound Name | cyclohexane-1,2,3,4-tetrol;methanol |
| PubChem CID | 70613200 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | cyclohexane-1,2,3,4-tetrol;methanol |
| SMILES | CO.OC1CCC(O)C(O)C1O |
| InChI | InChI=1S/C6H12O4.CH4O/c7-3-1-2-4(8)6(10)5(3)9;1-2/h3-10H,1-2H2;2H,1H3 |
| InChIKey | LHDGJPSZYYOECT-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexane-1,2,3,4-tetrol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,2,3,4-tetrol;methanol?
The IUPAC name of cyclohexane-1,2,3,4-tetrol;methanol (CID 70613200) is cyclohexane-1,2,3,4-tetrol;methanol.
What is the SMILES notation for cyclohexane-1,2,3,4-tetrol;methanol?
The canonical SMILES for cyclohexane-1,2,3,4-tetrol;methanol is CO.OC1CCC(O)C(O)C1O.
What is the InChIKey of cyclohexane-1,2,3,4-tetrol;methanol?
The InChIKey is LHDGJPSZYYOECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4.CH4O/c7-3-1-2-4(8)6(10)5(3)9;1-2/h3-10H,1-2H2;2H,1H3.
What are the key properties of cyclohexane-1,2,3,4-tetrol;methanol?
cyclohexane-1,2,3,4-tetrol;methanol has a molecular weight of 180.20 g/mol, XLogP of -2.17, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,2,3,4-tetrol;methanol is sourced from PubChem (CID 70613200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).