C12H15FN2O — CID 22885763
(1S,2S,3S)-3-amino-2-(4-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 22885763) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is (1S,2S,3S)-3-amino-2-(4-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | (1S,2S,3S)-3-amino-2-(4-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 22885763 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (1S,2S,3S)-3-amino-2-(4-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CC[C@H](N)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FN2O/c13-8-3-1-7(2-4-8)11-9(12(15)16)5-6-10(11)14/h1-4,9-11H,5-6,14H2,(H2,15,16)/t9-,10-,11+/m0/s1 |
| InChIKey | KOZNIWIKYPGMNY-GARJFASQSA-N |
| XLogP | 1.13 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |