C12H13FNO2W- — CID 59215176
(3S,4R)-4-(4-fluorophenyl)piperidin-1-ide-3-carboxylic acid;tungsten (PubChem CID 59215176) has the molecular formula C12H13FNO2W- and a molecular weight of 406.08 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluorophenyl)piperidin-1-ide-3-carboxylic acid;tungsten.
| Compound Name | (3S,4R)-4-(4-fluorophenyl)piperidin-1-ide-3-carboxylic acid;tungsten |
|---|---|
| PubChem CID | 59215176 |
| Molecular Formula | C12H13FNO2W- |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | (3S,4R)-4-(4-fluorophenyl)piperidin-1-ide-3-carboxylic acid;tungsten |
| SMILES | O=C(O)[C@@H]1C[N-]CC[C@H]1c1ccc(F)cc1.[W] |
| InChI | InChI=1S/C12H13FNO2.W/c13-9-3-1-8(2-4-9)10-5-6-14-7-11(10)12(15)16;/h1-4,10-11H,5-7H2,(H,15,16);/q-1;/t10-,11+;/m0./s1 |
| InChIKey | XMCGFEXXLMURFB-VZXYPILPSA-N |
| XLogP | 2.38 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |