C15H16FNO5 — CID 155964479
2-[[2-(4-fluorophenyl)cyclobutanecarbonyl]amino]butanedioic acid (PubChem CID 155964479) has the molecular formula C15H16FNO5 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)cyclobutanecarbonyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(4-fluorophenyl)cyclobutanecarbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 155964479 |
| Molecular Formula | C15H16FNO5 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)cyclobutanecarbonyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)C1CCC1c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C15H16FNO5/c16-9-3-1-8(2-4-9)10-5-6-11(10)14(20)17-12(15(21)22)7-13(18)19/h1-4,10-12H,5-7H2,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | QSLFZWMUOSJXRT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |