About [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+)
[(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) (PubChem CID 58878699) has the molecular formula C12H15FNORb
and a molecular weight of 293.72 g/mol. Its IUPAC name is [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+).
Molecular Properties
| Compound Name | [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) |
| PubChem CID | 58878699 |
| Molecular Formula | C12H15FNORb |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) |
| SMILES | OC[C@H]1C[N-]CC[C@@H]1c1ccc(F)cc1.[Rb+] |
| InChI | InChI=1S/C12H15FNO.Rb/c13-11-3-1-9(2-4-11)12-5-6-14-7-10(12)8-15;/h1-4,10,12,15H,5-8H2;/q-1;+1/t10-,12-;/m1./s1 |
| InChIKey | JXRVFMLYMOOZEX-MHDYBILJSA-N |
| XLogP | -0.70 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+)?
The IUPAC name of [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) (CID 58878699) is [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+).
What is the SMILES notation for [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+)?
The canonical SMILES for [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) is OC[C@H]1C[N-]CC[C@@H]1c1ccc(F)cc1.[Rb+].
What is the InChIKey of [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+)?
The InChIKey is JXRVFMLYMOOZEX-MHDYBILJSA-N. The full InChI is InChI=1S/C12H15FNO.Rb/c13-11-3-1-9(2-4-11)12-5-6-14-7-10(12)8-15;/h1-4,10,12,15H,5-8H2;/q-1;+1/t10-,12-;/m1./s1.
What are the key properties of [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+)?
[(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) has a molecular weight of 293.72 g/mol, XLogP of -0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(4-fluorophenyl)piperidin-1-id-3-yl]methanol;rubidium(1+) is sourced from PubChem (CID 58878699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).