C14H18FNO2 — CID 123536470
2-[(1R,3S,4R)-4-amino-3-(4-fluorophenyl)cyclohexyl]acetic acid (PubChem CID 123536470) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[(1R,3S,4R)-4-amino-3-(4-fluorophenyl)cyclohexyl]acetic acid.
| Compound Name | 2-[(1R,3S,4R)-4-amino-3-(4-fluorophenyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 123536470 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[(1R,3S,4R)-4-amino-3-(4-fluorophenyl)cyclohexyl]acetic acid |
| SMILES | N[C@@H]1CC[C@@H](CC(=O)O)C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO2/c15-11-4-2-10(3-5-11)12-7-9(8-14(17)18)1-6-13(12)16/h2-5,9,12-13H,1,6-8,16H2,(H,17,18)/t9-,12+,13-/m1/s1 |
| InChIKey | IHZWFPVRLPWGKF-JIMOISOXSA-N |
| XLogP | 2.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |