C16H22ClNO2 — CID 67129632
ethyl 2-[4-amino-3-(4-chlorophenyl)cyclohexyl]acetate (PubChem CID 67129632) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is ethyl 2-[4-amino-3-(4-chlorophenyl)cyclohexyl]acetate.
| Compound Name | ethyl 2-[4-amino-3-(4-chlorophenyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 67129632 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl 2-[4-amino-3-(4-chlorophenyl)cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(N)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H22ClNO2/c1-2-20-16(19)10-11-3-8-15(18)14(9-11)12-4-6-13(17)7-5-12/h4-7,11,14-15H,2-3,8-10,18H2,1H3 |
| InChIKey | VEVCIDYQDMXRPK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |