C17H23ClO2 — CID 171633291
methyl (2R)-2-(4-chlorophenyl)-4-propylcyclohexane-1-carboxylate (PubChem CID 171633291) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is methyl (2R)-2-(4-chlorophenyl)-4-propylcyclohexane-1-carboxylate.
| Compound Name | methyl (2R)-2-(4-chlorophenyl)-4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 171633291 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | methyl (2R)-2-(4-chlorophenyl)-4-propylcyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C(=O)OC)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H23ClO2/c1-3-4-12-5-10-15(17(19)20-2)16(11-12)13-6-8-14(18)9-7-13/h6-9,12,15-16H,3-5,10-11H2,1-2H3/t12?,15?,16-/m0/s1 |
| InChIKey | NJPQUPFZRNOXQL-MOQPWLNLSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |