C12H14ClNO2 — CID 11207186
methyl (2S,3R)-2-(4-chlorophenyl)pyrrolidine-3-carboxylate (PubChem CID 11207186) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is methyl (2S,3R)-2-(4-chlorophenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3R)-2-(4-chlorophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11207186 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | methyl (2S,3R)-2-(4-chlorophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO2/c1-16-12(15)10-6-7-14-11(10)8-2-4-9(13)5-3-8/h2-5,10-11,14H,6-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | QKLYFEQFNHOFEP-GHMZBOCLSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |