C12H13Cl2NO2 — CID 51616375
methyl (2R,3R)-2-(2,4-dichlorophenyl)pyrrolidine-3-carboxylate (PubChem CID 51616375) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is methyl (2R,3R)-2-(2,4-dichlorophenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (2R,3R)-2-(2,4-dichlorophenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 51616375 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | methyl (2R,3R)-2-(2,4-dichlorophenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO2/c1-17-12(16)9-4-5-15-11(9)8-3-2-7(13)6-10(8)14/h2-3,6,9,11,15H,4-5H2,1H3/t9-,11+/m1/s1 |
| InChIKey | RFRBPJHBTIEEOF-KOLCDFICSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |