C17H28FNOSi — CID 102251714
(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)cyclopentan-1-amine (PubChem CID 102251714) has the molecular formula C17H28FNOSi and a molecular weight of 309.50 g/mol. Its IUPAC name is (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)cyclopentan-1-amine.
| Compound Name | (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 102251714 |
| Molecular Formula | C17H28FNOSi |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)cyclopentan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@H](N)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H28FNOSi/c1-17(2,3)21(4,5)20-15-11-10-14(19)16(15)12-6-8-13(18)9-7-12/h6-9,14-16H,10-11,19H2,1-5H3/t14-,15+,16+/m1/s1 |
| InChIKey | MNMKSEGDGHUTMF-PMPSAXMXSA-N |
| XLogP | 4.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|