C16H26F3NOSi — CID 142637755
4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3,4-trifluorophenyl)butan-1-amine (PubChem CID 142637755) has the molecular formula C16H26F3NOSi and a molecular weight of 333.47 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3,4-trifluorophenyl)butan-1-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3,4-trifluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 142637755 |
| Molecular Formula | C16H26F3NOSi |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(2,3,4-trifluorophenyl)butan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(CN)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H26F3NOSi/c1-16(2,3)22(4,5)21-9-8-11(10-20)12-6-7-13(17)15(19)14(12)18/h6-7,11H,8-10,20H2,1-5H3 |
| InChIKey | XYHACBFBEFUULF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|