C17H28FNOSi — CID 21341071
tert-butyl-[[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane (PubChem CID 21341071) has the molecular formula C17H28FNOSi and a molecular weight of 309.50 g/mol. Its IUPAC name is tert-butyl-[[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 21341071 |
| Molecular Formula | C17H28FNOSi |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl-[[(3R,4S)-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CNC[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H28FNOSi/c1-17(2,3)21(4,5)20-12-14-10-19-11-16(14)13-7-6-8-15(18)9-13/h6-9,14,16,19H,10-12H2,1-5H3/t14-,16-/m1/s1 |
| InChIKey | QGYQAWTVDIEPPQ-GDBMZVCRSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|