C16H26FNOSi — CID 66689125
tert-butyl-[(3S)-2-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane (PubChem CID 66689125) has the molecular formula C16H26FNOSi and a molecular weight of 295.47 g/mol. Its IUPAC name is tert-butyl-[(3S)-2-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S)-2-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66689125 |
| Molecular Formula | C16H26FNOSi |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl-[(3S)-2-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCNC1c1cccc(F)c1 |
| InChI | InChI=1S/C16H26FNOSi/c1-16(2,3)20(4,5)19-14-9-10-18-15(14)12-7-6-8-13(17)11-12/h6-8,11,14-15,18H,9-10H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | RYYZWDLBBXCKAE-MLCCFXAWSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|