C22H36FNOSi — CID 134813866
(3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-amine (PubChem CID 134813866) has the molecular formula C22H36FNOSi and a molecular weight of 377.62 g/mol. Its IUPAC name is (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-amine.
| Compound Name | (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-amine |
|---|---|
| PubChem CID | 134813866 |
| Molecular Formula | C22H36FNOSi |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | (3S,4Z)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-9-fluoronona-1,4-dien-3-amine |
| SMILES | C=C[C@H](NCc1ccccc1)/C(=C/CCCCF)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36FNOSi/c1-7-20(24-18-19-14-10-8-11-15-19)21(16-12-9-13-17-23)25-26(5,6)22(2,3)4/h7-8,10-11,14-16,20,24H,1,9,12-13,17-18H2,2-6H3/b21-16-/t20-/m0/s1 |
| InChIKey | SJJOQYJEBUFMEO-CVVHJZTLSA-N |
| XLogP | 6.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|