C17H29F2NOSi — CID 21255688
1-[tert-butyl(dimethyl)silyl]oxy-N-[(2,4-difluorophenyl)methyl]-2-methylpropan-2-amine (PubChem CID 21255688) has the molecular formula C17H29F2NOSi and a molecular weight of 329.51 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-N-[(2,4-difluorophenyl)methyl]-2-methylpropan-2-amine.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-N-[(2,4-difluorophenyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 21255688 |
| Molecular Formula | C17H29F2NOSi |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-N-[(2,4-difluorophenyl)methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C17H29F2NOSi/c1-16(2,3)22(6,7)21-12-17(4,5)20-11-13-8-9-14(18)10-15(13)19/h8-10,20H,11-12H2,1-7H3 |
| InChIKey | FCHKNODQJGHSKI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|