C16H29NOSi — CID 122223185
(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenylpropan-2-amine (PubChem CID 122223185) has the molecular formula C16H29NOSi and a molecular weight of 279.50 g/mol. Its IUPAC name is (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenylpropan-2-amine.
| Compound Name | (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 122223185 |
| Molecular Formula | C16H29NOSi |
| Molecular Weight | 279.50 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenylpropan-2-amine |
| SMILES | CN[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H29NOSi/c1-13(17-5)15(14-11-9-8-10-12-14)18-19(6,7)16(2,3)4/h8-13,15,17H,1-7H3/t13-,15-/m1/s1 |
| InChIKey | WIKYZIWJVSQTNP-UKRRQHHQSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|