C18H28Cl2O2Si — CID 15444578
(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-2-methyl-1-phenylpentan-3-one (PubChem CID 15444578) has the molecular formula C18H28Cl2O2Si and a molecular weight of 375.41 g/mol. Its IUPAC name is (1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-2-methyl-1-phenylpentan-3-one.
| Compound Name | (1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-2-methyl-1-phenylpentan-3-one |
|---|---|
| PubChem CID | 15444578 |
| Molecular Formula | C18H28Cl2O2Si |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-2-methyl-1-phenylpentan-3-one |
| SMILES | C[C@H](C(=O)C(C)(Cl)Cl)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H28Cl2O2Si/c1-13(16(21)18(5,19)20)15(14-11-9-8-10-12-14)22-23(6,7)17(2,3)4/h8-13,15H,1-7H3/t13-,15-/m0/s1 |
| InChIKey | KMHBDCKZGNRWQD-ZFWWWQNUSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|