C38H50O2Si2 — CID 11467474
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(4-phenylphenyl)ethoxy]-dimethylsilane (PubChem CID 11467474) has the molecular formula C38H50O2Si2 and a molecular weight of 594.99 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(4-phenylphenyl)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(4-phenylphenyl)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11467474 |
| Molecular Formula | C38H50O2Si2 |
| Molecular Weight | 594.99 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-1,2-bis(4-phenylphenyl)ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ccc(-c2ccccc2)cc1)C(O[Si](C)(C)C(C)(C)C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H50O2Si2/c1-37(2,3)41(7,8)39-35(33-25-21-31(22-26-33)29-17-13-11-14-18-29)36(40-42(9,10)38(4,5)6)34-27-23-32(24-28-34)30-19-15-12-16-20-30/h11-28,35-36H,1-10H3 |
| InChIKey | CGQRDRAGCYTKJN-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.99 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|