C16H26OSi — CID 11230810
tert-butyl-dimethyl-(1-phenylbut-3-enoxy)silane (PubChem CID 11230810) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1-phenylbut-3-enoxy)silane.
| Compound Name | tert-butyl-dimethyl-(1-phenylbut-3-enoxy)silane |
|---|---|
| PubChem CID | 11230810 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | tert-butyl-dimethyl-(1-phenylbut-3-enoxy)silane |
| SMILES | C=CCC(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H26OSi/c1-7-11-15(14-12-9-8-10-13-14)17-18(5,6)16(2,3)4/h7-10,12-13,15H,1,11H2,2-6H3 |
| InChIKey | HQEQHSSHKFCSTG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|