C22H30O3SSi — CID 15534325
[(E)-4-(benzenesulfonyl)-1-phenylbut-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 15534325) has the molecular formula C22H30O3SSi and a molecular weight of 402.63 g/mol. Its IUPAC name is [(E)-4-(benzenesulfonyl)-1-phenylbut-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E)-4-(benzenesulfonyl)-1-phenylbut-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15534325 |
| Molecular Formula | C22H30O3SSi |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(E)-4-(benzenesulfonyl)-1-phenylbut-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(C/C=C/S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O3SSi/c1-22(2,3)27(4,5)25-21(19-13-8-6-9-14-19)17-12-18-26(23,24)20-15-10-7-11-16-20/h6-16,18,21H,17H2,1-5H3/b18-12+ |
| InChIKey | LLENEVNBXCMURR-LDADJPATSA-N |
| XLogP | 6.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|