About [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene
[(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene (PubChem CID 101203977) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene |
| PubChem CID | 101203977 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene |
| SMILES | CC(C)(C)C/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2,3)10-7-11-16(14,15)12-8-5-4-6-9-12/h4-9,11H,10H2,1-3H3/b11-7+ |
| InChIKey | PTPSSMWRFAMADH-YRNVUSSQSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene?
The IUPAC name of [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene (CID 101203977) is [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene.
What is the SMILES notation for [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene?
The canonical SMILES for [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene is CC(C)(C)C/C=C/S(=O)(=O)c1ccccc1.
What is the InChIKey of [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene?
The InChIKey is PTPSSMWRFAMADH-YRNVUSSQSA-N. The full InChI is InChI=1S/C13H18O2S/c1-13(2,3)10-7-11-16(14,15)12-8-5-4-6-9-12/h4-9,11H,10H2,1-3H3/b11-7+.
What are the key properties of [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene?
[(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene has a molecular weight of 238.35 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene is sourced from PubChem (CID 101203977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).