C13H18O2S — CID 101203977
[(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene (PubChem CID 101203977) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene.
| Compound Name | [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 101203977 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(E)-4,4-dimethylpent-1-enyl]sulfonylbenzene |
| SMILES | CC(C)(C)C/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2,3)10-7-11-16(14,15)12-8-5-4-6-9-12/h4-9,11H,10H2,1-3H3/b11-7+ |
| InChIKey | PTPSSMWRFAMADH-YRNVUSSQSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |